Table 1 Enriched fragments with SMILES code, IUPAC name, chemical structure, and source (organism)
From: Identifying enriched drug fragments as possible candidates for metabolic engineering
Enriched fragment | IUPAC name | Structure | Source |
|---|---|---|---|
CCCc1ccc(cc1)O | 4-Propylphenol |
| Brassica napus (Rapeseed) |
CCCCCCCCCCCC | Dodecane |
| Pisum sativum (pea) |
CCCCCCCCC(=O)O | Nonanoic acid |
| Pisum sativum (pea) |
C(=O)CCCC[N+] | 5-Amino pentanal |
| Arabidopsis thaliana (thale cress) |
O=c1[nH]c(=O)c2c(n1C)nc[nH]2 | Caffeine |
| Camellia irrawadiensis |
OC(=O)[C@H](Cc1c[nH]c2c1cccc2)N | L-Tryptophan |
| Sinapis alba (white mustard) |
C/C=C/c1ccccc1 | Styrene |
| Saccharomyces Cerevisiae (budding yeast) |
Cc1c[nH]c(=O)[nH]c1=O | Thymine |
| Rhodotorula glutinis |
O=C1[C@@H](N)[C@@H]2N1C(=C(CS2)C)C(=O)O | 3-Methyl-7-aminoceph-3-em-4-carboxylic acid |
| Acremonium chrysogenum |
